C15H20ClN3OS — CID 119280242
(2S)-2-amino-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methylsulfanylbutanamide (PubChem CID 119280242) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119280242 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2S)-2-amino-N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H20ClN3OS/c1-21-7-5-13(17)15(20)18-6-4-10-9-19-14-3-2-11(16)8-12(10)14/h2-3,8-9,13,19H,4-7,17H2,1H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | HUAZEKCIGPOGFF-ZDUSSCGKSA-N |
| XLogP | 2.56 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |