C12H16ClN3 — CID 57176365
4-(5-chloro-1H-indol-3-yl)butane-1,2-diamine (PubChem CID 57176365) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 4-(5-chloro-1H-indol-3-yl)butane-1,2-diamine.
| Compound Name | 4-(5-chloro-1H-indol-3-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 57176365 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4-(5-chloro-1H-indol-3-yl)butane-1,2-diamine |
| SMILES | NCC(N)CCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H16ClN3/c13-9-2-4-12-11(5-9)8(7-16-12)1-3-10(15)6-14/h2,4-5,7,10,16H,1,3,6,14-15H2 |
| InChIKey | CXCCKYCNGPHYRO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |