C19H28N2O — CID 17271853
2-ethyl-N-[2-(5-methyl-1H-indol-3-yl)ethyl]hexanamide (PubChem CID 17271853) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-ethyl-N-[2-(5-methyl-1H-indol-3-yl)ethyl]hexanamide.
| Compound Name | 2-ethyl-N-[2-(5-methyl-1H-indol-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 17271853 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-ethyl-N-[2-(5-methyl-1H-indol-3-yl)ethyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)NCCc1c[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C19H28N2O/c1-4-6-7-15(5-2)19(22)20-11-10-16-13-21-18-9-8-14(3)12-17(16)18/h8-9,12-13,15,21H,4-7,10-11H2,1-3H3,(H,20,22) |
| InChIKey | LLUVOKGTTOXMGI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |