C20H18Cl3N3O — CID 153405493
(2R)-2-(chloroamino)-3-(3-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one (PubChem CID 153405493) has the molecular formula C20H18Cl3N3O and a molecular weight of 422.74 g/mol. Its IUPAC name is (2R)-2-(chloroamino)-3-(3-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one.
| Compound Name | (2R)-2-(chloroamino)-3-(3-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 153405493 |
| Molecular Formula | C20H18Cl3N3O |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (2R)-2-(chloroamino)-3-(3-chlorophenyl)-1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
| SMILES | O=C([C@@H](Cc1cccc(Cl)c1)NCl)N1CCc2c([nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H18Cl3N3O/c21-13-3-1-2-12(8-13)9-18(25-23)20(27)26-7-6-15-16-10-14(22)4-5-17(16)24-19(15)11-26/h1-5,8,10,18,24-25H,6-7,9,11H2/t18-/m1/s1 |
| InChIKey | KJGLGCMTRSDJSH-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|