C18H21ClN4O3 — CID 166935735
5-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-formamido-N-methyl-5-oxopentanamide (PubChem CID 166935735) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 5-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-formamido-N-methyl-5-oxopentanamide.
| Compound Name | 5-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-formamido-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166935735 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 5-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-formamido-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1)NC=O |
| InChI | InChI=1S/C18H21ClN4O3/c1-20-18(26)15(21-10-24)4-5-17(25)23-7-6-12-13-8-11(19)2-3-14(13)22-16(12)9-23/h2-3,8,10,15,22H,4-7,9H2,1H3,(H,20,26)(H,21,24) |
| InChIKey | SMQWCWFIFLCVCZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|