C20H23ClN4O — CID 16677481
1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-(3,5-dimethylpyrazol-1-yl)butan-1-one (PubChem CID 16677481) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-(3,5-dimethylpyrazol-1-yl)butan-1-one.
| Compound Name | 1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-(3,5-dimethylpyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 16677481 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-4-(3,5-dimethylpyrazol-1-yl)butan-1-one |
| SMILES | Cc1cc(C)n(CCCC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2)n1 |
| InChI | InChI=1S/C20H23ClN4O/c1-13-10-14(2)25(23-13)8-3-4-20(26)24-9-7-16-17-11-15(21)5-6-18(17)22-19(16)12-24/h5-6,10-11,22H,3-4,7-9,12H2,1-2H3 |
| InChIKey | GMNXEZPLVXLNRS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|