C11H12ClN3O2S — CID 146387568
6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide (PubChem CID 146387568) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide.
| Compound Name | 6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
|---|---|
| PubChem CID | 146387568 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
| SMILES | NS(=O)(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-7-1-2-10-9(5-7)8-3-4-15(18(13,16)17)6-11(8)14-10/h1-2,5,14H,3-4,6H2,(H2,13,16,17) |
| InChIKey | AYBYDLSVKAICME-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|