C19H16Cl2N2O — CID 159614505
(6-chloro-7-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(3-chlorophenyl)methanone (PubChem CID 159614505) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is (6-chloro-7-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(3-chlorophenyl)methanone.
| Compound Name | (6-chloro-7-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 159614505 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (6-chloro-7-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-(3-chlorophenyl)methanone |
| SMILES | Cc1cc2[nH]c3c(c2cc1Cl)CCN(C(=O)c1cccc(Cl)c1)C3 |
| InChI | InChI=1S/C19H16Cl2N2O/c1-11-7-17-15(9-16(11)21)14-5-6-23(10-18(14)22-17)19(24)12-3-2-4-13(20)8-12/h2-4,7-9,22H,5-6,10H2,1H3 |
| InChIKey | MNCPZEDMUCAGPE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|