C19H17ClF2N2O — CID 146387791
2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-difluorophenyl)ethanol (PubChem CID 146387791) has the molecular formula C19H17ClF2N2O and a molecular weight of 362.81 g/mol. Its IUPAC name is 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 146387791 |
| Molecular Formula | C19H17ClF2N2O |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-difluorophenyl)ethanol |
| SMILES | OC(CN1CCc2c([nH]c3ccc(Cl)cc23)C1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17ClF2N2O/c20-12-2-4-17-14(8-12)13-5-6-24(9-18(13)23-17)10-19(25)11-1-3-15(21)16(22)7-11/h1-4,7-8,19,23,25H,5-6,9-10H2 |
| InChIKey | LFFFRSVIXDAOPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|