C21H23Cl3N2O — CID 153405374
2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-dichlorophenyl)ethanol;ethane (PubChem CID 153405374) has the molecular formula C21H23Cl3N2O and a molecular weight of 425.79 g/mol. Its IUPAC name is 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-dichlorophenyl)ethanol;ethane.
| Compound Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-dichlorophenyl)ethanol;ethane |
|---|---|
| PubChem CID | 153405374 |
| Molecular Formula | C21H23Cl3N2O |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,4-dichlorophenyl)ethanol;ethane |
| SMILES | CC.OC(CN1CCc2c([nH]c3ccc(Cl)cc23)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl3N2O.C2H6/c20-12-2-4-17-14(8-12)13-5-6-24(9-18(13)23-17)10-19(25)11-1-3-15(21)16(22)7-11;1-2/h1-4,7-8,19,23,25H,5-6,9-10H2;1-2H3 |
| InChIKey | YLHXRHHNXNGJPI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|