C19H18Cl3N3O — CID 146387802
2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(4,5-dichloro-2-pyridinyl)ethanol (PubChem CID 146387802) has the molecular formula C19H18Cl3N3O and a molecular weight of 410.73 g/mol. Its IUPAC name is 2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(4,5-dichloro-2-pyridinyl)ethanol.
| Compound Name | 2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(4,5-dichloro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 146387802 |
| Molecular Formula | C19H18Cl3N3O |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(4,5-dichloro-2-pyridinyl)ethanol |
| SMILES | CC1c2[nH]c3ccc(Cl)cc3c2CCN1CC(O)c1cc(Cl)c(Cl)cn1 |
| InChI | InChI=1S/C19H18Cl3N3O/c1-10-19-12(13-6-11(20)2-3-16(13)24-19)4-5-25(10)9-18(26)17-7-14(21)15(22)8-23-17/h2-3,6-8,10,18,24,26H,4-5,9H2,1H3 |
| InChIKey | HJVUMWFYFBHUSJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|