C20H19Cl2N3O3 — CID 146387637
2-[6-chloro-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(4-chloro-2-hydroxyphenyl)acetamide (PubChem CID 146387637) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is 2-[6-chloro-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(4-chloro-2-hydroxyphenyl)acetamide.
| Compound Name | 2-[6-chloro-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(4-chloro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 146387637 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-[6-chloro-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-N-(4-chloro-2-hydroxyphenyl)acetamide |
| SMILES | O=C(CN1CCc2c([nH]c3ccc(Cl)cc23)C1CO)Nc1ccc(Cl)cc1O |
| InChI | InChI=1S/C20H19Cl2N3O3/c21-11-1-3-15-14(7-11)13-5-6-25(17(10-26)20(13)24-15)9-19(28)23-16-4-2-12(22)8-18(16)27/h1-4,7-8,17,24,26-27H,5-6,9-10H2,(H,23,28) |
| InChIKey | NZNYKSWWJNEXHK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|