C19H17Cl2N3O3 — CID 146387778
6-chloro-N-(3-chloro-5-hydroxyphenyl)-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 146387778) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is 6-chloro-N-(3-chloro-5-hydroxyphenyl)-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 6-chloro-N-(3-chloro-5-hydroxyphenyl)-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 146387778 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 6-chloro-N-(3-chloro-5-hydroxyphenyl)-1-(hydroxymethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1cc(O)cc(Cl)c1)N1CCc2c([nH]c3ccc(Cl)cc23)C1CO |
| InChI | InChI=1S/C19H17Cl2N3O3/c20-10-1-2-16-15(7-10)14-3-4-24(17(9-25)18(14)23-16)19(27)22-12-5-11(21)6-13(26)8-12/h1-2,5-8,17,23,25-26H,3-4,9H2,(H,22,27) |
| InChIKey | ZQFINRCOVAACRC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|