C20H16Cl2F3N3O2 — CID 66871556
N-(3,5-dichlorophenyl)-6-methoxy-1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 66871556) has the molecular formula C20H16Cl2F3N3O2 and a molecular weight of 458.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-6-methoxy-1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-6-methoxy-1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 66871556 |
| Molecular Formula | C20H16Cl2F3N3O2 |
| Molecular Weight | 458.27 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | N-(3,5-dichlorophenyl)-6-methoxy-1-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)Nc1cc(Cl)cc(Cl)c1)C3C(F)(F)F |
| InChI | InChI=1S/C20H16Cl2F3N3O2/c1-30-13-2-3-16-15(9-13)14-4-5-28(18(17(14)27-16)20(23,24)25)19(29)26-12-7-10(21)6-11(22)8-12/h2-3,6-9,18,27H,4-5H2,1H3,(H,26,29) |
| InChIKey | AERAHDRPOXSRCV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|