C20H16ClF4N3O — CID 23113753
N-(3-chloro-5-fluorophenyl)-1-(trifluoromethyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide (PubChem CID 23113753) has the molecular formula C20H16ClF4N3O and a molecular weight of 425.81 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-1-(trifluoromethyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)-1-(trifluoromethyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 23113753 |
| Molecular Formula | C20H16ClF4N3O |
| Molecular Weight | 425.81 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-1-(trifluoromethyl)-3,4,5,10-tetrahydro-1H-azepino[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(Cl)c1)N1CCCc2c([nH]c3ccccc23)C1C(F)(F)F |
| InChI | InChI=1S/C20H16ClF4N3O/c21-11-8-12(22)10-13(9-11)26-19(29)28-7-3-5-15-14-4-1-2-6-16(14)27-17(15)18(28)20(23,24)25/h1-2,4,6,8-10,18,27H,3,5,7H2,(H,26,29) |
| InChIKey | SCENHXOYMHWGEV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|