C13H16ClFN2O — CID 103774779
N-(3-chloro-5-fluorophenyl)azepane-1-carboxamide (PubChem CID 103774779) has the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)azepane-1-carboxamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 103774779 |
| Molecular Formula | C13H16ClFN2O |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)azepane-1-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(Cl)c1)N1CCCCCC1 |
| InChI | InChI=1S/C13H16ClFN2O/c14-10-7-11(15)9-12(8-10)16-13(18)17-5-3-1-2-4-6-17/h7-9H,1-6H2,(H,16,18) |
| InChIKey | UYNYCBRLXSEDQF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |