C18H17ClF2N2O2 — CID 23072136
N-(3-chloro-5-fluorophenyl)-4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxamide (PubChem CID 23072136) has the molecular formula C18H17ClF2N2O2 and a molecular weight of 366.80 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)-4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 23072136 |
| Molecular Formula | C18H17ClF2N2O2 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(Cl)c1)N1CCC(O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H17ClF2N2O2/c19-13-9-15(21)11-16(10-13)22-17(24)23-7-5-18(25,6-8-23)12-1-3-14(20)4-2-12/h1-4,9-11,25H,5-8H2,(H,22,24) |
| InChIKey | HQTFIBROPUDXCI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |