C17H22Cl2N2O2 — CID 23072018
4-cyclopentyl-N-(3,5-dichlorophenyl)-4-hydroxypiperidine-1-carboxamide (PubChem CID 23072018) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 4-cyclopentyl-N-(3,5-dichlorophenyl)-4-hydroxypiperidine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-(3,5-dichlorophenyl)-4-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 23072018 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-cyclopentyl-N-(3,5-dichlorophenyl)-4-hydroxypiperidine-1-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)N1CCC(O)(C2CCCC2)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c18-13-9-14(19)11-15(10-13)20-16(22)21-7-5-17(23,6-8-21)12-3-1-2-4-12/h9-12,23H,1-8H2,(H,20,22) |
| InChIKey | QCCKMPYBKMBBEN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |