C10H11Cl2N3O — CID 107654152
3-amino-N-(3,5-dichlorophenyl)azetidine-1-carboxamide (PubChem CID 107654152) has the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. Its IUPAC name is 3-amino-N-(3,5-dichlorophenyl)azetidine-1-carboxamide.
| Compound Name | 3-amino-N-(3,5-dichlorophenyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 107654152 |
| Molecular Formula | C10H11Cl2N3O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 3-amino-N-(3,5-dichlorophenyl)azetidine-1-carboxamide |
| SMILES | NC1CN(C(=O)Nc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C10H11Cl2N3O/c11-6-1-7(12)3-9(2-6)14-10(16)15-4-8(13)5-15/h1-3,8H,4-5,13H2,(H,14,16) |
| InChIKey | YBZHRZVUPITBPQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |