C11H13Cl2N3O — CID 107654257
(3S)-3-amino-N-(3,5-dichlorophenyl)pyrrolidine-1-carboxamide (PubChem CID 107654257) has the molecular formula C11H13Cl2N3O and a molecular weight of 274.15 g/mol. Its IUPAC name is (3S)-3-amino-N-(3,5-dichlorophenyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-amino-N-(3,5-dichlorophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 107654257 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (3S)-3-amino-N-(3,5-dichlorophenyl)pyrrolidine-1-carboxamide |
| SMILES | N[C@H]1CCN(C(=O)Nc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C11H13Cl2N3O/c12-7-3-8(13)5-10(4-7)15-11(17)16-2-1-9(14)6-16/h3-5,9H,1-2,6,14H2,(H,15,17)/t9-/m0/s1 |
| InChIKey | AKVUAOZLUVJQRM-VIFPVBQESA-N |
| XLogP | 2.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |