C11H15N3O — CID 94340040
(3R)-3-amino-N-phenylpyrrolidine-1-carboxamide (PubChem CID 94340040) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (3R)-3-amino-N-phenylpyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-amino-N-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94340040 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (3R)-3-amino-N-phenylpyrrolidine-1-carboxamide |
| SMILES | N[C@@H]1CCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C11H15N3O/c12-9-6-7-14(8-9)11(15)13-10-4-2-1-3-5-10/h1-5,9H,6-8,12H2,(H,13,15)/t9-/m1/s1 |
| InChIKey | MFYRCAHFLPMSEM-SECBINFHSA-N |
| XLogP | 1.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |