C11H14BrN3O — CID 164946130
3-amino-N-(3-bromophenyl)pyrrolidine-1-carboxamide (PubChem CID 164946130) has the molecular formula C11H14BrN3O and a molecular weight of 284.16 g/mol. Its IUPAC name is 3-amino-N-(3-bromophenyl)pyrrolidine-1-carboxamide.
| Compound Name | 3-amino-N-(3-bromophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 164946130 |
| Molecular Formula | C11H14BrN3O |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 3-amino-N-(3-bromophenyl)pyrrolidine-1-carboxamide |
| SMILES | NC1CCN(C(=O)Nc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C11H14BrN3O/c12-8-2-1-3-10(6-8)14-11(16)15-5-4-9(13)7-15/h1-3,6,9H,4-5,7,13H2,(H,14,16) |
| InChIKey | WGYOLUQIRYTXEL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |