C12H15ClF3N3OS — CID 154903217
3-amino-N-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-1-carboxamide;hydrochloride (PubChem CID 154903217) has the molecular formula C12H15ClF3N3OS and a molecular weight of 341.79 g/mol. Its IUPAC name is 3-amino-N-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154903217 |
| Molecular Formula | C12H15ClF3N3OS |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-amino-N-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidine-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)Nc2cccc(SC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H14F3N3OS.ClH/c13-12(14,15)20-10-3-1-2-9(6-10)17-11(19)18-5-4-8(16)7-18;/h1-3,6,8H,4-5,7,16H2,(H,17,19);1H |
| InChIKey | HIXWOALYAMVIAB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |