C17H25ClN4O2 — CID 119411060
3-[(3R)-3-aminopyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide;hydrochloride (PubChem CID 119411060) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 3-[(3R)-3-aminopyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide;hydrochloride.
| Compound Name | 3-[(3R)-3-aminopyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119411060 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-[(3R)-3-aminopyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)C2CCCN(C(=O)Nc3ccccc3)C2)C1 |
| InChI | InChI=1S/C17H24N4O2.ClH/c18-14-8-10-20(12-14)16(22)13-5-4-9-21(11-13)17(23)19-15-6-2-1-3-7-15;/h1-3,6-7,13-14H,4-5,8-12,18H2,(H,19,23);1H/t13?,14-;/m1./s1 |
| InChIKey | GIEFSHANSHKGJL-BAGZVPGASA-N |
| XLogP | 1.91 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |