C18H25N3O2S — CID 95145547
(3S)-3-[(2S)-2-methylthiomorpholine-4-carbonyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 95145547) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is (3S)-3-[(2S)-2-methylthiomorpholine-4-carbonyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-[(2S)-2-methylthiomorpholine-4-carbonyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95145547 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (3S)-3-[(2S)-2-methylthiomorpholine-4-carbonyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | C[C@H]1CN(C(=O)[C@H]2CCCN(C(=O)Nc3ccccc3)C2)CCS1 |
| InChI | InChI=1S/C18H25N3O2S/c1-14-12-20(10-11-24-14)17(22)15-6-5-9-21(13-15)18(23)19-16-7-3-2-4-8-16/h2-4,7-8,14-15H,5-6,9-13H2,1H3,(H,19,23)/t14-,15-/m0/s1 |
| InChIKey | FUKHUOPOOOWCFB-GJZGRUSLSA-N |
| XLogP | 2.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |