C13H15N2O3- — CID 2113074
1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 2113074) has the molecular formula C13H15N2O3- and a molecular weight of 247.27 g/mol. Its IUPAC name is 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2113074 |
| Molecular Formula | C13H15N2O3- |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | O=C([O-])C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(17)10-6-8-15(9-7-10)13(18)14-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,14,18)(H,16,17)/p-1 |
| InChIKey | FQYHUUNCGUFBAM-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |