C24H30N2O3 — CID 23071773
4-cyclohexyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide (PubChem CID 23071773) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-cyclohexyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-cyclohexyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23071773 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 4-cyclohexyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)N1CCC(O)(C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c27-23(26-16-14-24(28,15-17-26)19-8-3-1-4-9-19)25-20-10-7-13-22(18-20)29-21-11-5-2-6-12-21/h2,5-7,10-13,18-19,28H,1,3-4,8-9,14-17H2,(H,25,27) |
| InChIKey | MIGOZXDLXRSRAO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |