C21H25N3O3 — CID 91835309
(4aS,8aS)-4a-hydroxy-N-(4-pyridin-3-yloxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide (PubChem CID 91835309) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (4aS,8aS)-4a-hydroxy-N-(4-pyridin-3-yloxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide.
| Compound Name | (4aS,8aS)-4a-hydroxy-N-(4-pyridin-3-yloxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 91835309 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (4aS,8aS)-4a-hydroxy-N-(4-pyridin-3-yloxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2cccnc2)cc1)N1CC[C@@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C21H25N3O3/c25-20(24-13-11-21(26)10-2-1-4-16(21)15-24)23-17-6-8-18(9-7-17)27-19-5-3-12-22-14-19/h3,5-9,12,14,16,26H,1-2,4,10-11,13,15H2,(H,23,25)/t16-,21-/m0/s1 |
| InChIKey | ARAKIUZSROWEKS-KKSFZXQISA-N |
| XLogP | 4.03 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |