C21H24N2O3 — CID 23071756
4-cyclopropyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide (PubChem CID 23071756) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-cyclopropyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-cyclopropyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23071756 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-cyclopropyl-4-hydroxy-N-(3-phenoxyphenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)N1CCC(O)(C2CC2)CC1 |
| InChI | InChI=1S/C21H24N2O3/c24-20(23-13-11-21(25,12-14-23)16-9-10-16)22-17-5-4-8-19(15-17)26-18-6-2-1-3-7-18/h1-8,15-16,25H,9-14H2,(H,22,24) |
| InChIKey | IIDHERPALXAUTO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |