C21H26N4O2 — CID 97434495
3-[(2S)-2-methylpiperidin-1-yl]-N-(4-pyridin-3-yloxyphenyl)azetidine-1-carboxamide (PubChem CID 97434495) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[(2S)-2-methylpiperidin-1-yl]-N-(4-pyridin-3-yloxyphenyl)azetidine-1-carboxamide.
| Compound Name | 3-[(2S)-2-methylpiperidin-1-yl]-N-(4-pyridin-3-yloxyphenyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 97434495 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 3-[(2S)-2-methylpiperidin-1-yl]-N-(4-pyridin-3-yloxyphenyl)azetidine-1-carboxamide |
| SMILES | C[C@H]1CCCCN1C1CN(C(=O)Nc2ccc(Oc3cccnc3)cc2)C1 |
| InChI | InChI=1S/C21H26N4O2/c1-16-5-2-3-12-25(16)18-14-24(15-18)21(26)23-17-7-9-19(10-8-17)27-20-6-4-11-22-13-20/h4,6-11,13,16,18H,2-3,5,12,14-15H2,1H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | PPWSPGDYFCXBNH-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |