C15H21N3O2 — CID 81256985
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-3-pyridinyl)methanone (PubChem CID 81256985) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-3-pyridinyl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 81256985 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-amino-3-pyridinyl)methanone |
| SMILES | Nc1ccncc1C(=O)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C15H21N3O2/c16-13-4-7-17-9-12(13)14(19)18-8-6-15(20)5-2-1-3-11(15)10-18/h4,7,9,11,20H,1-3,5-6,8,10H2,(H2,16,17) |
| InChIKey | UKKBVLLWENCNSU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |