C16H20BrNO2S — CID 107032962
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-bromo-2-sulfanylphenyl)methanone (PubChem CID 107032962) has the molecular formula C16H20BrNO2S and a molecular weight of 370.31 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-bromo-2-sulfanylphenyl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-bromo-2-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107032962 |
| Molecular Formula | C16H20BrNO2S |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(4-bromo-2-sulfanylphenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1S)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H20BrNO2S/c17-12-4-5-13(14(21)9-12)15(19)18-8-7-16(20)6-2-1-3-11(16)10-18/h4-5,9,11,20-21H,1-3,6-8,10H2 |
| InChIKey | CYPQSWUEYWYLHL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|