C16H19BrClNO2 — CID 103827033
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3-bromo-5-chlorophenyl)methanone (PubChem CID 103827033) has the molecular formula C16H19BrClNO2 and a molecular weight of 372.69 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3-bromo-5-chlorophenyl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3-bromo-5-chlorophenyl)methanone |
|---|---|
| PubChem CID | 103827033 |
| Molecular Formula | C16H19BrClNO2 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3-bromo-5-chlorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(Br)c1)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H19BrClNO2/c17-13-7-11(8-14(18)9-13)15(20)19-6-5-16(21)4-2-1-3-12(16)10-19/h7-9,12,21H,1-6,10H2 |
| InChIKey | ZJQNPGFUDHBDRA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |