C16H19BrFNO2 — CID 81096047
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(2-bromo-4-fluorophenyl)methanone (PubChem CID 81096047) has the molecular formula C16H19BrFNO2 and a molecular weight of 356.24 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(2-bromo-4-fluorophenyl)methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(2-bromo-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 81096047 |
| Molecular Formula | C16H19BrFNO2 |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(2-bromo-4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1Br)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H19BrFNO2/c17-14-9-12(18)4-5-13(14)15(20)19-8-7-16(21)6-2-1-3-11(16)10-19/h4-5,9,11,21H,1-3,6-8,10H2 |
| InChIKey | XDCSNONFPVRMAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |