C29H37FN2O6S — CID 155322982
(4aS,8aS)-N-[3-(4-fluorophenoxy)-5-(4-methylsulfonylcyclohexyl)oxyphenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide (PubChem CID 155322982) has the molecular formula C29H37FN2O6S and a molecular weight of 560.69 g/mol. Its IUPAC name is (4aS,8aS)-N-[3-(4-fluorophenoxy)-5-(4-methylsulfonylcyclohexyl)oxyphenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide.
| Compound Name | (4aS,8aS)-N-[3-(4-fluorophenoxy)-5-(4-methylsulfonylcyclohexyl)oxyphenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 155322982 |
| Molecular Formula | C29H37FN2O6S |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (4aS,8aS)-N-[3-(4-fluorophenoxy)-5-(4-methylsulfonylcyclohexyl)oxyphenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
| SMILES | CS(=O)(=O)C1CCC(Oc2cc(NC(=O)N3CC[C@@]4(O)CCCC[C@H]4C3)cc(Oc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C29H37FN2O6S/c1-39(35,36)27-11-9-24(10-12-27)38-26-17-22(16-25(18-26)37-23-7-5-21(30)6-8-23)31-28(33)32-15-14-29(34)13-3-2-4-20(29)19-32/h5-8,16-18,20,24,27,34H,2-4,9-15,19H2,1H3,(H,31,33)/t20-,24?,27?,29-/m0/s1 |
| InChIKey | NMINMSGQHKRQFM-JEFKWEDGSA-N |
| XLogP | 5.51 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |