C18H22FNO2 — CID 71966098
1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 71966098) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is 1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71966098 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(F)cc1)N1CC[C@@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H22FNO2/c19-16-7-4-14(5-8-16)6-9-17(21)20-12-11-18(22)10-2-1-3-15(18)13-20/h4-9,15,22H,1-3,10-13H2/t15-,18-/m0/s1 |
| InChIKey | DKZWGWFIHJSOAQ-YJBOKZPZSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|