C16H14ClFN2O2 — CID 86816888
N-(2-chlorophenyl)-3-(4-fluorophenyl)-3-hydroxyazetidine-1-carboxamide (PubChem CID 86816888) has the molecular formula C16H14ClFN2O2 and a molecular weight of 320.75 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(4-fluorophenyl)-3-hydroxyazetidine-1-carboxamide.
| Compound Name | N-(2-chlorophenyl)-3-(4-fluorophenyl)-3-hydroxyazetidine-1-carboxamide |
|---|---|
| PubChem CID | 86816888 |
| Molecular Formula | C16H14ClFN2O2 |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(2-chlorophenyl)-3-(4-fluorophenyl)-3-hydroxyazetidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)N1CC(O)(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H14ClFN2O2/c17-13-3-1-2-4-14(13)19-15(21)20-9-16(22,10-20)11-5-7-12(18)8-6-11/h1-8,22H,9-10H2,(H,19,21) |
| InChIKey | WGRQYGLQTVOXIH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |