C17H15ClFN3O3 — CID 154860174
N-(4-carbamoyl-2-fluorophenyl)-3-(4-chlorophenyl)-3-hydroxyazetidine-1-carboxamide (PubChem CID 154860174) has the molecular formula C17H15ClFN3O3 and a molecular weight of 363.78 g/mol. Its IUPAC name is N-(4-carbamoyl-2-fluorophenyl)-3-(4-chlorophenyl)-3-hydroxyazetidine-1-carboxamide.
| Compound Name | N-(4-carbamoyl-2-fluorophenyl)-3-(4-chlorophenyl)-3-hydroxyazetidine-1-carboxamide |
|---|---|
| PubChem CID | 154860174 |
| Molecular Formula | C17H15ClFN3O3 |
| Molecular Weight | 363.78 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-(4-carbamoyl-2-fluorophenyl)-3-(4-chlorophenyl)-3-hydroxyazetidine-1-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)N2CC(O)(c3ccc(Cl)cc3)C2)c(F)c1 |
| InChI | InChI=1S/C17H15ClFN3O3/c18-12-4-2-11(3-5-12)17(25)8-22(9-17)16(24)21-14-6-1-10(15(20)23)7-13(14)19/h1-7,25H,8-9H2,(H2,20,23)(H,21,24) |
| InChIKey | FWFJCWXTIQESPF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |