C15H16ClFN4O2 — CID 71920493
4-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]-3-fluorobenzamide (PubChem CID 71920493) has the molecular formula C15H16ClFN4O2 and a molecular weight of 338.77 g/mol. Its IUPAC name is 4-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]-3-fluorobenzamide.
| Compound Name | 4-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]-3-fluorobenzamide |
|---|---|
| PubChem CID | 71920493 |
| Molecular Formula | C15H16ClFN4O2 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[[(4-chloro-1-methylpyrrol-2-yl)methyl-methylcarbamoyl]amino]-3-fluorobenzamide |
| SMILES | CN(Cc1cc(Cl)cn1C)C(=O)Nc1ccc(C(N)=O)cc1F |
| InChI | InChI=1S/C15H16ClFN4O2/c1-20-7-10(16)6-11(20)8-21(2)15(23)19-13-4-3-9(14(18)22)5-12(13)17/h3-7H,8H2,1-2H3,(H2,18,22)(H,19,23) |
| InChIKey | YDKYDHDBEMUBSR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |