C15H13ClFN3O — CID 60804116
N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-4-chloro-1-methylpyrrole-2-carboxamide (PubChem CID 60804116) has the molecular formula C15H13ClFN3O and a molecular weight of 305.74 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-4-chloro-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-4-chloro-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60804116 |
| Molecular Formula | C15H13ClFN3O |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-4-chloro-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Cl)cc1C(=O)Nc1ccc(C#CCN)cc1F |
| InChI | InChI=1S/C15H13ClFN3O/c1-20-9-11(16)8-14(20)15(21)19-13-5-4-10(3-2-6-18)7-12(13)17/h4-5,7-9H,6,18H2,1H3,(H,19,21) |
| InChIKey | NYXQSVJQKQTQRO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|