C14H11FN2O2 — CID 60804299
N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]furan-3-carboxamide (PubChem CID 60804299) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]furan-3-carboxamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 60804299 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]furan-3-carboxamide |
| SMILES | NCC#Cc1ccc(NC(=O)c2ccoc2)c(F)c1 |
| InChI | InChI=1S/C14H11FN2O2/c15-12-8-10(2-1-6-16)3-4-13(12)17-14(18)11-5-7-19-9-11/h3-5,7-9H,6,16H2,(H,17,18) |
| InChIKey | LHCFIIJLRFRBBJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|