C15H10FNO4 — CID 60802943
N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxopyran-3-carboxamide (PubChem CID 60802943) has the molecular formula C15H10FNO4 and a molecular weight of 287.25 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxopyran-3-carboxamide.
| Compound Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 60802943 |
| Molecular Formula | C15H10FNO4 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-6-oxopyran-3-carboxamide |
| SMILES | O=C(Nc1ccc(C#CCO)cc1F)c1ccc(=O)oc1 |
| InChI | InChI=1S/C15H10FNO4/c16-12-8-10(2-1-7-18)3-5-13(12)17-15(20)11-4-6-14(19)21-9-11/h3-6,8-9,18H,7H2,(H,17,20) |
| InChIKey | WFUBCRJTWWYPEN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|