C13H12FNO2 — CID 60803979
N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]cyclopropanecarboxamide (PubChem CID 60803979) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 60803979 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(C#CCO)cc1F)C1CC1 |
| InChI | InChI=1S/C13H12FNO2/c14-11-8-9(2-1-7-16)3-6-12(11)15-13(17)10-4-5-10/h3,6,8,10,16H,4-5,7H2,(H,15,17) |
| InChIKey | OZJWKIVOKPFZDK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|