C16H18FNO2 — CID 107181275
N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-2-methylcyclopentane-1-carboxamide (PubChem CID 107181275) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-2-methylcyclopentane-1-carboxamide.
| Compound Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-2-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 107181275 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-2-methylcyclopentane-1-carboxamide |
| SMILES | CC1CCCC1C(=O)Nc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C16H18FNO2/c1-11-4-2-6-13(11)16(20)18-15-8-7-12(5-3-9-19)10-14(15)17/h7-8,10-11,13,19H,2,4,6,9H2,1H3,(H,18,20) |
| InChIKey | ACMUXHREPPTTOS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|