C15H17FN2O — CID 107002393
N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 107002393) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 107002393 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)Nc1ccc(C#CCN)cc1F |
| InChI | InChI=1S/C15H17FN2O/c1-15(2)9-11(15)14(19)18-13-6-5-10(4-3-7-17)8-12(13)16/h5-6,8,11H,7,9,17H2,1-2H3,(H,18,19) |
| InChIKey | YQSGEDDSIXJRPE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|