C18H24N2O — CID 107181388
N-[4-(3-aminoprop-1-ynyl)-2-methylphenyl]-2,2-dimethylcyclopentane-1-carboxamide (PubChem CID 107181388) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)-2-methylphenyl]-2,2-dimethylcyclopentane-1-carboxamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)-2-methylphenyl]-2,2-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 107181388 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)-2-methylphenyl]-2,2-dimethylcyclopentane-1-carboxamide |
| SMILES | Cc1cc(C#CCN)ccc1NC(=O)C1CCCC1(C)C |
| InChI | InChI=1S/C18H24N2O/c1-13-12-14(6-5-11-19)8-9-16(13)20-17(21)15-7-4-10-18(15,2)3/h8-9,12,15H,4,7,10-11,19H2,1-3H3,(H,20,21) |
| InChIKey | QDUAIPYYBITDHP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|