C13H16ClFN2O3 — CID 136553187
N-(4-chloro-2-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 136553187) has the molecular formula C13H16ClFN2O3 and a molecular weight of 302.73 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 136553187 |
| Molecular Formula | C13H16ClFN2O3 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)N1CCC(O)(CO)CC1 |
| InChI | InChI=1S/C13H16ClFN2O3/c14-9-1-2-11(10(15)7-9)16-12(19)17-5-3-13(20,8-18)4-6-17/h1-2,7,18,20H,3-6,8H2,(H,16,19) |
| InChIKey | VJEQHYBXNALNSG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |