C14H17Cl2FN2O3 — CID 97445518
(4R)-N-(2,4-dichloro-5-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)azepane-1-carboxamide (PubChem CID 97445518) has the molecular formula C14H17Cl2FN2O3 and a molecular weight of 351.21 g/mol. Its IUPAC name is (4R)-N-(2,4-dichloro-5-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)azepane-1-carboxamide.
| Compound Name | (4R)-N-(2,4-dichloro-5-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 97445518 |
| Molecular Formula | C14H17Cl2FN2O3 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (4R)-N-(2,4-dichloro-5-fluorophenyl)-4-hydroxy-4-(hydroxymethyl)azepane-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c(Cl)cc1Cl)N1CCC[C@](O)(CO)CC1 |
| InChI | InChI=1S/C14H17Cl2FN2O3/c15-9-6-10(16)12(7-11(9)17)18-13(21)19-4-1-2-14(22,8-20)3-5-19/h6-7,20,22H,1-5,8H2,(H,18,21)/t14-/m1/s1 |
| InChIKey | AUWKUKFDUDDGBA-CQSZACIVSA-N |
| XLogP | 2.87 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|