C15H21ClN2O3 — CID 136518198
N-(4-chloro-2-methylphenyl)-4-hydroxy-4-(methoxymethyl)piperidine-1-carboxamide (PubChem CID 136518198) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-4-hydroxy-4-(methoxymethyl)piperidine-1-carboxamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-4-hydroxy-4-(methoxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 136518198 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-4-hydroxy-4-(methoxymethyl)piperidine-1-carboxamide |
| SMILES | COCC1(O)CCN(C(=O)Nc2ccc(Cl)cc2C)CC1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-11-9-12(16)3-4-13(11)17-14(19)18-7-5-15(20,6-8-18)10-21-2/h3-4,9,20H,5-8,10H2,1-2H3,(H,17,19) |
| InChIKey | RQHWALUGQPUBJJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |