C21H32N2O3 — CID 126446437
(4S)-4-hydroxy-4-(hydroxymethyl)-N-[(1-phenylcyclohexyl)methyl]azepane-1-carboxamide (PubChem CID 126446437) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (4S)-4-hydroxy-4-(hydroxymethyl)-N-[(1-phenylcyclohexyl)methyl]azepane-1-carboxamide.
| Compound Name | (4S)-4-hydroxy-4-(hydroxymethyl)-N-[(1-phenylcyclohexyl)methyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 126446437 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (4S)-4-hydroxy-4-(hydroxymethyl)-N-[(1-phenylcyclohexyl)methyl]azepane-1-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCCC1)N1CCC[C@@](O)(CO)CC1 |
| InChI | InChI=1S/C21H32N2O3/c24-17-21(26)12-7-14-23(15-13-21)19(25)22-16-20(10-5-2-6-11-20)18-8-3-1-4-9-18/h1,3-4,8-9,24,26H,2,5-7,10-17H2,(H,22,25)/t21-/m0/s1 |
| InChIKey | HDXJEGVMWKNPEJ-NRFANRHFSA-N |
| XLogP | 2.81 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |